C20H23N3O4 — CID 166982721
3-[1,3-dioxo-4-(piperidin-4-ylmethylamino)inden-2-yl]piperidine-2,6-dione (PubChem CID 166982721) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[1,3-dioxo-4-(piperidin-4-ylmethylamino)inden-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1,3-dioxo-4-(piperidin-4-ylmethylamino)inden-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166982721 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-[1,3-dioxo-4-(piperidin-4-ylmethylamino)inden-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(C2C(=O)c3cccc(NCC4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H23N3O4/c24-15-5-4-13(20(27)23-15)17-18(25)12-2-1-3-14(16(12)19(17)26)22-10-11-6-8-21-9-7-11/h1-3,11,13,17,21-22H,4-10H2,(H,23,24,27) |
| InChIKey | IFGGMJTWOMHKIW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|