C25H37N5O2 — CID 172587233
3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-1-methyl-2,3-dihydroindazol-3-yl]piperidine-2,6-dione (PubChem CID 172587233) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-1-methyl-2,3-dihydroindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-1-methyl-2,3-dihydroindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172587233 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-1-methyl-2,3-dihydroindazol-3-yl]piperidine-2,6-dione |
| SMILES | CN1NC(C2CCC(=O)NC2=O)c2ccc(NC3CCN(CC4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C25H37N5O2/c1-29-22-15-19(7-8-20(22)24(28-29)21-9-10-23(31)27-25(21)32)26-18-11-13-30(14-12-18)16-17-5-3-2-4-6-17/h7-8,15,17-18,21,24,26,28H,2-6,9-14,16H2,1H3,(H,27,31,32) |
| InChIKey | TWSRPTUUHOELNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|