C24H32FN5O3 — CID 170953540
3-[5-[4-(cyclohexylmethyl)piperazin-1-yl]-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 170953540) has the molecular formula C24H32FN5O3 and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[5-[4-(cyclohexylmethyl)piperazin-1-yl]-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-(cyclohexylmethyl)piperazin-1-yl]-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170953540 |
| Molecular Formula | C24H32FN5O3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-[5-[4-(cyclohexylmethyl)piperazin-1-yl]-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(N3CCN(CC4CCCCC4)CC3)c(F)c21 |
| InChI | InChI=1S/C24H32FN5O3/c1-27-22-18(30(24(27)33)19-9-10-20(31)26-23(19)32)8-7-17(21(22)25)29-13-11-28(12-14-29)15-16-5-3-2-4-6-16/h7-8,16,19H,2-6,9-15H2,1H3,(H,26,31,32) |
| InChIKey | RHORAQDFIMIBAC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|