C20H27FN4O3 — CID 170952758
ethane;3-(4-fluoro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 170952758) has the molecular formula C20H27FN4O3 and a molecular weight of 390.46 g/mol. Its IUPAC name is ethane;3-(4-fluoro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | ethane;3-(4-fluoro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170952758 |
| Molecular Formula | C20H27FN4O3 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | ethane;3-(4-fluoro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | CC.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCNCC3)c(F)c21 |
| InChI | InChI=1S/C18H21FN4O3.C2H6/c1-22-16-12(3-2-11(15(16)19)10-6-8-20-9-7-10)23(18(22)26)13-4-5-14(24)21-17(13)25;1-2/h2-3,10,13,20H,4-9H2,1H3,(H,21,24,25);1-2H3 |
| InChIKey | WWNVRJFDSDBKNQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|