C22H34ClN4O3P — CID 166549570
3-(4-chloro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione;methylphosphane;propane (PubChem CID 166549570) has the molecular formula C22H34ClN4O3P and a molecular weight of 468.97 g/mol. Its IUPAC name is 3-(4-chloro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione;methylphosphane;propane.
| Compound Name | 3-(4-chloro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione;methylphosphane;propane |
|---|---|
| PubChem CID | 166549570 |
| Molecular Formula | C22H34ClN4O3P |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-(4-chloro-3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione;methylphosphane;propane |
| SMILES | CCC.CP.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCNCC3)c(Cl)c21 |
| InChI | InChI=1S/C18H21ClN4O3.C3H8.CH5P/c1-22-16-12(3-2-11(15(16)19)10-6-8-20-9-7-10)23(18(22)26)13-4-5-14(24)21-17(13)25;1-3-2;1-2/h2-3,10,13,20H,4-9H2,1H3,(H,21,24,25);3H2,1-2H3;2H2,1H3 |
| InChIKey | WCCWEBNKUONMNT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|