C15H18N2O2 — CID 154967466
(3S)-3-(2,3-dihydro-1H-inden-1-ylmethylamino)piperidine-2,6-dione (PubChem CID 154967466) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (3S)-3-(2,3-dihydro-1H-inden-1-ylmethylamino)piperidine-2,6-dione.
| Compound Name | (3S)-3-(2,3-dihydro-1H-inden-1-ylmethylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 154967466 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (3S)-3-(2,3-dihydro-1H-inden-1-ylmethylamino)piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](NCC2CCc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C15H18N2O2/c18-14-8-7-13(15(19)17-14)16-9-11-6-5-10-3-1-2-4-12(10)11/h1-4,11,13,16H,5-9H2,(H,17,18,19)/t11?,13-/m0/s1 |
| InChIKey | UHYWYLJDKBZHTQ-YUZLPWPTSA-N |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|