C19H23NO5 — CID 86715059
2-[(3R,8E,11S)-3-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetic acid (PubChem CID 86715059) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[(3R,8E,11S)-3-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetic acid.
| Compound Name | 2-[(3R,8E,11S)-3-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 86715059 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[(3R,8E,11S)-3-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C/C=C/CCC(=O)N[C@H](Cc2ccccc2)COC1=O |
| InChI | InChI=1S/C19H23NO5/c21-17-10-6-2-5-9-15(12-18(22)23)19(24)25-13-16(20-17)11-14-7-3-1-4-8-14/h1-5,7-8,15-16H,6,9-13H2,(H,20,21)(H,22,23)/b5-2+/t15-,16+/m0/s1 |
| InChIKey | UJEGQLSJFNRFPQ-ILUPXTIESA-N |
| XLogP | 2.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|