C33H42N2O5 — CID 4154881
3,13-dibenzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotetradec-8-ene-5,14-dione (PubChem CID 4154881) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is 3,13-dibenzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotetradec-8-ene-5,14-dione.
| Compound Name | 3,13-dibenzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotetradec-8-ene-5,14-dione |
|---|---|
| PubChem CID | 4154881 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 3,13-dibenzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotetradec-8-ene-5,14-dione |
| SMILES | O=C1NC(Cc2ccccc2)COC(=O)C(Cc2ccccc2)CCCC=CCC1CC(=O)N1CCCC1CO |
| InChI | InChI=1S/C33H42N2O5/c36-23-30-18-11-19-35(30)31(37)22-27-16-9-1-2-10-17-28(20-25-12-5-3-6-13-25)33(39)40-24-29(34-32(27)38)21-26-14-7-4-8-15-26/h1,3-9,12-15,27-30,36H,2,10-11,16-24H2,(H,34,38) |
| InChIKey | OYSLGUPYKRJGOJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|