C25H34N2O5 — CID 5175862
3-benzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotridec-8-ene-5,13-dione (PubChem CID 5175862) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-benzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotridec-8-ene-5,13-dione.
| Compound Name | 3-benzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotridec-8-ene-5,13-dione |
|---|---|
| PubChem CID | 5175862 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-benzyl-6-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-1-oxa-4-azacyclotridec-8-ene-5,13-dione |
| SMILES | O=C1CCCC=CCC(CC(=O)N2CCCC2CO)C(=O)NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C25H34N2O5/c28-17-22-12-8-14-27(22)23(29)16-20-11-6-1-2-7-13-24(30)32-18-21(26-25(20)31)15-19-9-4-3-5-10-19/h1,3-6,9-10,20-22,28H,2,7-8,11-18H2,(H,26,31) |
| InChIKey | XCJLTWIYYOTSQC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|