C30H43N3O7 — CID 6608777
benzyl N-[4-[(3S,6R)-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate (PubChem CID 6608777) has the molecular formula C30H43N3O7 and a molecular weight of 557.69 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R)-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R)-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6608777 |
| Molecular Formula | C30H43N3O7 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | benzyl N-[4-[(3S,6R)-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
| SMILES | O=C1CCCC=CC[C@H](CC(=O)N2CCC[C@H]2CO)C(=O)N[C@@H](CCCCNC(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C30H43N3O7/c34-20-26-15-10-18-33(26)27(35)19-24-13-6-1-2-7-16-28(36)39-22-25(32-29(24)37)14-8-9-17-31-30(38)40-21-23-11-4-3-5-12-23/h1,3-6,11-12,24-26,34H,2,7-10,13-22H2,(H,31,38)(H,32,37)/t24-,25+,26+/m1/s1 |
| InChIKey | LDBARKZVIGWZOV-ZNZIZOMTSA-N |
| XLogP | 3.23 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|