C36H49N3O7 — CID 6609250
benzyl N-[4-[(3S,6R,13R)-13-benzyl-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate (PubChem CID 6609250) has the molecular formula C36H49N3O7 and a molecular weight of 635.80 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R,13R)-13-benzyl-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R,13R)-13-benzyl-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6609250 |
| Molecular Formula | C36H49N3O7 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.36 |
| IUPAC Name | benzyl N-[4-[(3S,6R,13R)-13-benzyl-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
| SMILES | C[C@@H](CO)NC(=O)C[C@H]1CC=CCCC[C@H](Cc2ccccc2)C(=O)OC[C@H](CCCCNC(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C36H49N3O7/c1-27(24-40)38-33(41)23-30-18-10-2-3-11-19-31(22-28-14-6-4-7-15-28)35(43)45-26-32(39-34(30)42)20-12-13-21-37-36(44)46-25-29-16-8-5-9-17-29/h2,4-10,14-17,27,30-32,40H,3,11-13,18-26H2,1H3,(H,37,44)(H,38,41)(H,39,42)/t27-,30+,31+,32-/m0/s1 |
| InChIKey | WEWZVNMPVKPHOD-NEFBLYCDSA-N |
| XLogP | 4.60 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|