C41H51N3O7 — CID 6608813
benzyl N-[4-[(3S,6R,12R)-12-benzyl-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate (PubChem CID 6608813) has the molecular formula C41H51N3O7 and a molecular weight of 697.87 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R,12R)-12-benzyl-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R,12R)-12-benzyl-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6608813 |
| Molecular Formula | C41H51N3O7 |
| Molecular Weight | 697.87 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | benzyl N-[4-[(3S,6R,12R)-12-benzyl-6-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
| SMILES | O=C(NCCCC[C@H]1COC(=O)[C@@H](Cc2ccccc2)CCC=CC[C@H](CC(=O)N(CCO)Cc2ccccc2)C(=O)N1)OCc1ccccc1 |
| InChI | InChI=1S/C41H51N3O7/c45-26-25-44(29-33-17-7-2-8-18-33)38(46)28-35-21-11-4-12-22-36(27-32-15-5-1-6-16-32)40(48)50-31-37(43-39(35)47)23-13-14-24-42-41(49)51-30-34-19-9-3-10-20-34/h1-11,15-20,35-37,45H,12-14,21-31H2,(H,42,49)(H,43,47)/t35-,36-,37+/m1/s1 |
| InChIKey | ZNUMOCODROHEMY-RQOYOAKWSA-N |
| XLogP | 5.74 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|