C35H47N3O8 — CID 6607883
benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate (PubChem CID 6607883) has the molecular formula C35H47N3O8 and a molecular weight of 637.77 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6607883 |
| Molecular Formula | C35H47N3O8 |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate |
| SMILES | O=C(C[C@H]1CC=CC[C@H](Cc2ccccc2)C(=O)OC[C@H](CCCCNC(=O)OCc2ccccc2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C35H47N3O8/c39-20-22-44-21-19-36-32(40)24-29-15-7-8-16-30(23-27-11-3-1-4-12-27)34(42)45-26-31(38-33(29)41)17-9-10-18-37-35(43)46-25-28-13-5-2-6-14-28/h1-8,11-14,29-31,39H,9-10,15-26H2,(H,36,40)(H,37,43)(H,38,41)/t29-,30-,31+/m1/s1 |
| InChIKey | PJIKJMFNSUVSMR-OLUZHXLYSA-N |
| XLogP | 3.45 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|