C31H40N2O7 — CID 4093350
2-[11-benzyl-5,12-dioxo-3-(phenylmethoxymethyl)-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 4093350) has the molecular formula C31H40N2O7 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-[11-benzyl-5,12-dioxo-3-(phenylmethoxymethyl)-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[11-benzyl-5,12-dioxo-3-(phenylmethoxymethyl)-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 4093350 |
| Molecular Formula | C31H40N2O7 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2-[11-benzyl-5,12-dioxo-3-(phenylmethoxymethyl)-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(CC1CC=CCC(Cc2ccccc2)C(=O)OCC(COCc2ccccc2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C31H40N2O7/c34-16-18-38-17-15-32-29(35)20-26-13-7-8-14-27(19-24-9-3-1-4-10-24)31(37)40-23-28(33-30(26)36)22-39-21-25-11-5-2-6-12-25/h1-12,26-28,34H,13-23H2,(H,32,35)(H,33,36) |
| InChIKey | GYZSAHBRXONHCH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|