C30H38N2O6 — CID 4115749
2-(12-benzyl-5,13-dioxo-3-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 4115749) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is 2-(12-benzyl-5,13-dioxo-3-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-(12-benzyl-5,13-dioxo-3-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 4115749 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2-(12-benzyl-5,13-dioxo-3-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(CC1CC=CCCC(Cc2ccccc2)C(=O)OCC(c2ccccc2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C30H38N2O6/c33-17-19-37-18-16-31-28(34)21-25-14-8-3-9-15-26(20-23-10-4-1-5-11-23)30(36)38-22-27(32-29(25)35)24-12-6-2-7-13-24/h1-8,10-13,25-27,33H,9,14-22H2,(H,31,34)(H,32,35) |
| InChIKey | HRGXFMPZOPMAMM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|