C26H36N2O6 — CID 6608276
2-[(3R,8S,12S)-8-benzyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 6608276) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-[(3R,8S,12S)-8-benzyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[(3R,8S,12S)-8-benzyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 6608276 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[(3R,8S,12S)-8-benzyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(C[C@H]1CC=CC[C@@H](Cc2ccccc2)C(=O)OC[C@@H]2CCCN2C1=O)NCCOCCO |
| InChI | InChI=1S/C26H36N2O6/c29-14-16-33-15-12-27-24(30)18-21-9-4-5-10-22(17-20-7-2-1-3-8-20)26(32)34-19-23-11-6-13-28(23)25(21)31/h1-5,7-8,21-23,29H,6,9-19H2,(H,27,30)/t21-,22+,23+/m1/s1 |
| InChIKey | IAXBHWCCNYJQQD-VJBWXMMDSA-N |
| XLogP | 1.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|