C31H46N2O6 — CID 6605400
2-[(3S,6R,12R)-12-benzyl-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 6605400) has the molecular formula C31H46N2O6 and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-[(3S,6R,12R)-12-benzyl-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[(3S,6R,12R)-12-benzyl-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 6605400 |
| Molecular Formula | C31H46N2O6 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 2-[(3S,6R,12R)-12-benzyl-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(C[C@H]1CC=CCC[C@H](Cc2ccccc2)C(=O)OC[C@H](CC2CCCCC2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C31H46N2O6/c34-17-19-38-18-16-32-29(35)22-26-14-8-3-9-15-27(20-24-10-4-1-5-11-24)31(37)39-23-28(33-30(26)36)21-25-12-6-2-7-13-25/h1,3-5,8,10-11,25-28,34H,2,6-7,9,12-23H2,(H,32,35)(H,33,36)/t26-,27-,28+/m1/s1 |
| InChIKey | ADXAVPJCPVUDHP-FCEKVYKBSA-N |
| XLogP | 3.72 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|