C29H42N2O5 — CID 4091391
2-[11-benzyl-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(1-hydroxypropan-2-yl)acetamide (PubChem CID 4091391) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is 2-[11-benzyl-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(1-hydroxypropan-2-yl)acetamide.
| Compound Name | 2-[11-benzyl-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(1-hydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 4091391 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 2-[11-benzyl-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(1-hydroxypropan-2-yl)acetamide |
| SMILES | CC(CO)NC(=O)CC1CC=CCC(Cc2ccccc2)C(=O)OCC(CC2CCCCC2)NC1=O |
| InChI | InChI=1S/C29H42N2O5/c1-21(19-32)30-27(33)18-24-14-8-9-15-25(16-22-10-4-2-5-11-22)29(35)36-20-26(31-28(24)34)17-23-12-6-3-7-13-23/h2,4-5,8-11,21,23-26,32H,3,6-7,12-20H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | OKMQKRJXJHAWON-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|