C28H34N2O5 — CID 6608460
2-[(3R,6R,11S)-11-benzyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide (PubChem CID 6608460) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[(3R,6R,11S)-11-benzyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[(3R,6R,11S)-11-benzyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 6608460 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-[(3R,6R,11S)-11-benzyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@H](CO)NC(=O)C[C@H]1CC=CC[C@@H](Cc2ccccc2)C(=O)OC[C@@H](c2ccccc2)NC1=O |
| InChI | InChI=1S/C28H34N2O5/c1-20(18-31)29-26(32)17-23-14-8-9-15-24(16-21-10-4-2-5-11-21)28(34)35-19-25(30-27(23)33)22-12-6-3-7-13-22/h2-13,20,23-25,31H,14-19H2,1H3,(H,29,32)(H,30,33)/t20-,23-,24+,25+/m1/s1 |
| InChIKey | JFKLZIHOMFGGCQ-GATIMQMVSA-N |
| XLogP | 3.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|