C31H39N3O8 — CID 6607850
benzyl N-[(3S,6R,11R)-3-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]carbamate (PubChem CID 6607850) has the molecular formula C31H39N3O8 and a molecular weight of 581.67 g/mol. Its IUPAC name is benzyl N-[(3S,6R,11R)-3-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]carbamate.
| Compound Name | benzyl N-[(3S,6R,11R)-3-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]carbamate |
|---|---|
| PubChem CID | 6607850 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | benzyl N-[(3S,6R,11R)-3-benzyl-6-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]carbamate |
| SMILES | O=C(C[C@H]1CC=CC[C@@H](NC(=O)OCc2ccccc2)C(=O)OC[C@H](Cc2ccccc2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C31H39N3O8/c35-16-18-40-17-15-32-28(36)20-25-13-7-8-14-27(34-31(39)42-21-24-11-5-2-6-12-24)30(38)41-22-26(33-29(25)37)19-23-9-3-1-4-10-23/h1-12,25-27,35H,13-22H2,(H,32,36)(H,33,37)(H,34,39)/t25-,26+,27-/m1/s1 |
| InChIKey | YYCWRQVRYBBIDF-KWXIBIRDSA-N |
| XLogP | 2.03 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|