C38H46N2O7 — CID 4998837
2-[12-benzyl-5,13-dioxo-3-[(4-phenylmethoxyphenyl)methyl]-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 4998837) has the molecular formula C38H46N2O7 and a molecular weight of 642.79 g/mol. Its IUPAC name is 2-[12-benzyl-5,13-dioxo-3-[(4-phenylmethoxyphenyl)methyl]-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[12-benzyl-5,13-dioxo-3-[(4-phenylmethoxyphenyl)methyl]-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 4998837 |
| Molecular Formula | C38H46N2O7 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 2-[12-benzyl-5,13-dioxo-3-[(4-phenylmethoxyphenyl)methyl]-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(CC1CC=CCCC(Cc2ccccc2)C(=O)OCC(Cc2ccc(OCc3ccccc3)cc2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C38H46N2O7/c41-21-23-45-22-20-39-36(42)26-32-14-8-3-9-15-33(24-29-10-4-1-5-11-29)38(44)47-28-34(40-37(32)43)25-30-16-18-35(19-17-30)46-27-31-12-6-2-7-13-31/h1-8,10-13,16-19,32-34,41H,9,14-15,20-28H2,(H,39,42)(H,40,43) |
| InChIKey | KCHYYDIYYICWFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|