C40H49N3O7 — CID 6607794
benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate (PubChem CID 6607794) has the molecular formula C40H49N3O7 and a molecular weight of 683.85 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6607794 |
| Molecular Formula | C40H49N3O7 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | benzyl N-[4-[(3S,6R,11R)-11-benzyl-6-[2-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-oxoethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-en-3-yl]butyl]carbamate |
| SMILES | O=C(C[C@H]1CC=CC[C@H](Cc2ccccc2)C(=O)OC[C@H](CCCCNC(=O)OCc2ccccc2)NC1=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C40H49N3O7/c44-27-36(25-31-16-6-2-7-17-31)42-37(45)26-33-20-10-11-21-34(24-30-14-4-1-5-15-30)39(47)49-29-35(43-38(33)46)22-12-13-23-41-40(48)50-28-32-18-8-3-9-19-32/h1-11,14-19,33-36,44H,12-13,20-29H2,(H,41,48)(H,42,45)(H,43,46)/t33-,34-,35+,36-/m1/s1 |
| InChIKey | MXZCJSOAKHYPQZ-PEDCNLCOSA-N |
| XLogP | 5.05 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|