C43H52N4O9 — CID 3539751
benzyl N-[4-[12-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate (PubChem CID 3539751) has the molecular formula C43H52N4O9 and a molecular weight of 768.91 g/mol. Its IUPAC name is benzyl N-[4-[12-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[12-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 3539751 |
| Molecular Formula | C43H52N4O9 |
| Molecular Weight | 768.91 g/mol |
| Exact Mass | 768.37 |
| IUPAC Name | benzyl N-[4-[12-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[2-(1-hydroxypropan-2-ylamino)-2-oxoethyl]-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-3-yl]butyl]carbamate |
| SMILES | CC(CO)NC(=O)CC1CC=CCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OCC(CCCCNC(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C43H52N4O9/c1-29(25-48)45-39(49)24-31-16-6-3-7-22-38(47-43(53)56-28-37-35-20-10-8-18-33(35)34-19-9-11-21-36(34)37)41(51)54-27-32(46-40(31)50)17-12-13-23-44-42(52)55-26-30-14-4-2-5-15-30/h2-6,8-11,14-15,18-21,29,31-32,37-38,48H,7,12-13,16-17,22-28H2,1H3,(H,44,52)(H,45,49)(H,46,50)(H,47,53) |
| InChIKey | HZRKUKWKQXCIDE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|