C29H43N3O7 — CID 6609249
benzyl N-[4-[(3S,6R)-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate (PubChem CID 6609249) has the molecular formula C29H43N3O7 and a molecular weight of 545.68 g/mol. Its IUPAC name is benzyl N-[4-[(3S,6R)-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S,6R)-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 6609249 |
| Molecular Formula | C29H43N3O7 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | benzyl N-[4-[(3S,6R)-6-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
| SMILES | C[C@@H](CO)NC(=O)C[C@H]1CC=CCCCCC(=O)OC[C@H](CCCCNC(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C29H43N3O7/c1-22(19-33)31-26(34)18-24-14-8-3-2-4-9-16-27(35)38-21-25(32-28(24)36)15-10-11-17-30-29(37)39-20-23-12-6-5-7-13-23/h3,5-8,12-13,22,24-25,33H,2,4,9-11,14-21H2,1H3,(H,30,37)(H,31,34)(H,32,36)/t22-,24+,25-/m0/s1 |
| InChIKey | XGVDPLKQXVPBCA-CAOCKLPOSA-N |
| XLogP | 3.13 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|