C28H41N3O7 — CID 143884008
benzyl N-[4-[(6R,8Z)-6-[2-(2-hydroxyethylamino)-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate (PubChem CID 143884008) has the molecular formula C28H41N3O7 and a molecular weight of 531.65 g/mol. Its IUPAC name is benzyl N-[4-[(6R,8Z)-6-[2-(2-hydroxyethylamino)-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(6R,8Z)-6-[2-(2-hydroxyethylamino)-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 143884008 |
| Molecular Formula | C28H41N3O7 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | benzyl N-[4-[(6R,8Z)-6-[2-(2-hydroxyethylamino)-2-oxoethyl]-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-3-yl]butyl]carbamate |
| SMILES | O=C(C[C@H]1C/C=C\CCCCC(=O)OCC(CCCCNC(=O)OCc2ccccc2)NC1=O)NCCO |
| InChI | InChI=1S/C28H41N3O7/c32-18-17-29-25(33)19-23-13-7-2-1-3-8-15-26(34)37-21-24(31-27(23)35)14-9-10-16-30-28(36)38-20-22-11-5-4-6-12-22/h2,4-7,11-12,23-24,32H,1,3,8-10,13-21H2,(H,29,33)(H,30,36)(H,31,35)/b7-2-/t23-,24?/m1/s1 |
| InChIKey | DDJAFYBVINRRSQ-XBEFZLSMSA-N |
| XLogP | 2.75 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|