C30H38N2O5 — CID 5081476
N-benzyl-2-(3-benzyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 5081476) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is N-benzyl-2-(3-benzyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-(3-benzyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 5081476 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | N-benzyl-2-(3-benzyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C1CCCCC=CCC(CC(=O)N(CCO)Cc2ccccc2)C(=O)NC(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C30H38N2O5/c33-19-18-32(22-25-14-8-5-9-15-25)28(34)21-26-16-10-2-1-3-11-17-29(35)37-23-27(31-30(26)36)20-24-12-6-4-7-13-24/h2,4-10,12-15,26-27,33H,1,3,11,16-23H2,(H,31,36) |
| InChIKey | DESPKANTNOIPHU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|