C26H38N2O5 — CID 6609381
N-benzyl-2-[(3S,6R)-5,14-dioxo-3-propan-2-yl-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 6609381) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-benzyl-2-[(3S,6R)-5,14-dioxo-3-propan-2-yl-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(3S,6R)-5,14-dioxo-3-propan-2-yl-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 6609381 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | N-benzyl-2-[(3S,6R)-5,14-dioxo-3-propan-2-yl-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(C)[C@H]1COC(=O)CCCCC=CC[C@H](CC(=O)N(CCO)Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C26H38N2O5/c1-20(2)23-19-33-25(31)14-10-5-3-4-9-13-22(26(32)27-23)17-24(30)28(15-16-29)18-21-11-7-6-8-12-21/h4,6-9,11-12,20,22-23,29H,3,5,10,13-19H2,1-2H3,(H,27,32)/t22-,23-/m1/s1 |
| InChIKey | QCMSSFYEXXJCRB-DHIUTWEWSA-N |
| XLogP | 3.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|