C28H40N2O5 — CID 3316974
N-benzyl-2-[3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 3316974) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-benzyl-2-[3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 3316974 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | N-benzyl-2-[3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C1CCC=CCC(CC(=O)N(CCO)Cc2ccccc2)C(=O)NC(CC2CCCCC2)CO1 |
| InChI | InChI=1S/C28H40N2O5/c31-17-16-30(20-23-12-6-2-7-13-23)26(32)19-24-14-8-3-9-15-27(33)35-21-25(29-28(24)34)18-22-10-4-1-5-11-22/h2-3,6-8,12-13,22,24-25,31H,1,4-5,9-11,14-21H2,(H,29,34) |
| InChIKey | XIIGDRCAOWAHMR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|