C29H42N2O5 — CID 6608782
N-benzyl-2-[(3S,6R)-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 6608782) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is N-benzyl-2-[(3S,6R)-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(3S,6R)-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 6608782 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | N-benzyl-2-[(3S,6R)-3-(cyclohexylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C1CCCC=CC[C@H](CC(=O)N(CCO)Cc2ccccc2)C(=O)N[C@@H](CC2CCCCC2)CO1 |
| InChI | InChI=1S/C29H42N2O5/c32-18-17-31(21-24-13-7-4-8-14-24)27(33)20-25-15-9-1-2-10-16-28(34)36-22-26(30-29(25)35)19-23-11-5-3-6-12-23/h1,4,7-9,13-14,23,25-26,32H,2-3,5-6,10-12,15-22H2,(H,30,35)/t25-,26+/m1/s1 |
| InChIKey | OIGMWYMZWHIDJN-FTJBHMTQSA-N |
| XLogP | 4.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|