C29H36N2O5 — CID 3690775
N-benzyl-2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 3690775) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is N-benzyl-2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 3690775 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-benzyl-2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C1CCCCC=CCC(CC(=O)N(CCO)Cc2ccccc2)C(=O)NCC(c2ccccc2)O1 |
| InChI | InChI=1S/C29H36N2O5/c32-19-18-31(22-23-12-6-4-7-13-23)27(33)20-25-16-8-2-1-3-11-17-28(34)36-26(21-30-29(25)35)24-14-9-5-10-15-24/h2,4-10,12-15,25-26,32H,1,3,11,16-22H2,(H,30,35) |
| InChIKey | FYAAPKWSQSLZNE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|