C26H36N2O5 — CID 5173956
2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide (PubChem CID 5173956) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide.
| Compound Name | 2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 5173956 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-(5,14-dioxo-2-phenyl-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
| SMILES | O=C(CC1CC=CCCCCC(=O)OC(c2ccccc2)CNC1=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C26H36N2O5/c29-19-26(15-9-10-16-26)28-23(30)17-21-13-5-2-1-3-8-14-24(31)33-22(18-27-25(21)32)20-11-6-4-7-12-20/h2,4-7,11-12,21-22,29H,1,3,8-10,13-19H2,(H,27,32)(H,28,30) |
| InChIKey | RMVFIJOSOGCDHS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|