C19H23NO5 — CID 118867236
2-[(2R,6S,8E)-5,13-dioxo-2-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl]acetic acid (PubChem CID 118867236) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[(2R,6S,8E)-5,13-dioxo-2-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl]acetic acid.
| Compound Name | 2-[(2R,6S,8E)-5,13-dioxo-2-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl]acetic acid |
|---|---|
| PubChem CID | 118867236 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[(2R,6S,8E)-5,13-dioxo-2-phenyl-1-oxa-4-azacyclotridec-8-en-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C/C=C/CCCC(=O)O[C@H](c2ccccc2)CNC1=O |
| InChI | InChI=1S/C19H23NO5/c21-17(22)12-15-10-4-1-2-7-11-18(23)25-16(13-20-19(15)24)14-8-5-3-6-9-14/h1,3-6,8-9,15-16H,2,7,10-13H2,(H,20,24)(H,21,22)/b4-1+/t15-,16-/m0/s1 |
| InChIKey | RQXFUIYSBQWJAC-BUTKQFFLSA-N |
| XLogP | 2.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|