C22H30N2O6 — CID 6608435
2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 6608435) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 6608435 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(C[C@H]1CC=CCCC(=O)O[C@@H](c2ccccc2)CNC1=O)NCCOCCO |
| InChI | InChI=1S/C22H30N2O6/c25-12-14-29-13-11-23-20(26)15-18-9-5-2-6-10-21(27)30-19(16-24-22(18)28)17-7-3-1-4-8-17/h1-5,7-8,18-19,25H,6,9-16H2,(H,23,26)(H,24,28)/t18-,19-/m1/s1 |
| InChIKey | FMCOXFDKGSWFID-RTBURBONSA-N |
| XLogP | 1.26 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|