C31H39N3O4 — CID 123479393
N-[(1-benzylpiperidin-4-yl)methyl]-2-[(6S)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide (PubChem CID 123479393) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-2-[(6S)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-2-[(6S)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 123479393 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-2-[(6S)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
| SMILES | O=C(C[C@@H]1CC=CCCC(=O)OC(c2ccccc2)CNC1=O)NCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H39N3O4/c35-29(32-21-24-16-18-34(19-17-24)23-25-10-4-1-5-11-25)20-27-14-8-3-9-15-30(36)38-28(22-33-31(27)37)26-12-6-2-7-13-26/h1-8,10-13,24,27-28H,9,14-23H2,(H,32,35)(H,33,37)/t27-,28?/m0/s1 |
| InChIKey | ZVTMGQQMHQJGRN-MBMZGMDYSA-N |
| XLogP | 4.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|