C24H34N2O7 — CID 4066622
N-[2-(2-hydroxyethoxy)ethyl]-2-[3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide (PubChem CID 4066622) has the molecular formula C24H34N2O7 and a molecular weight of 462.54 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-[3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 4066622 |
| Molecular Formula | C24H34N2O7 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
| SMILES | COCC1NC(=O)C(CC(=O)NCCOCCO)CC=CCCC(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C24H34N2O7/c1-31-17-20-23(18-8-4-2-5-9-18)33-22(29)11-7-3-6-10-19(24(30)26-20)16-21(28)25-12-14-32-15-13-27/h2-6,8-9,19-20,23,27H,7,10-17H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | IHDYDKNOZAHFSK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|