C18H30N2O6 — CID 4064309
2-(3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 4064309) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-(3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 4064309 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-(3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | CC1(C)COC(=O)CCC=CCC(CC(=O)NCCOCCO)C(=O)N1 |
| InChI | InChI=1S/C18H30N2O6/c1-18(2)13-26-16(23)7-5-3-4-6-14(17(24)20-18)12-15(22)19-8-10-25-11-9-21/h3-4,14,21H,5-13H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | POWHHWDXFKMKLB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|