C37H50N2O6 — CID 58348080
benzyl N-[4-[(3R,6R,8Z,13R)-13-benzyl-5,14-dioxo-6-[2-oxo-2-(propan-2-ylamino)ethyl]-1-oxacyclotetradec-8-en-3-yl]butyl]carbamate (PubChem CID 58348080) has the molecular formula C37H50N2O6 and a molecular weight of 618.82 g/mol. Its IUPAC name is benzyl N-[4-[(3R,6R,8Z,13R)-13-benzyl-5,14-dioxo-6-[2-oxo-2-(propan-2-ylamino)ethyl]-1-oxacyclotetradec-8-en-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3R,6R,8Z,13R)-13-benzyl-5,14-dioxo-6-[2-oxo-2-(propan-2-ylamino)ethyl]-1-oxacyclotetradec-8-en-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 58348080 |
| Molecular Formula | C37H50N2O6 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | benzyl N-[4-[(3R,6R,8Z,13R)-13-benzyl-5,14-dioxo-6-[2-oxo-2-(propan-2-ylamino)ethyl]-1-oxacyclotetradec-8-en-3-yl]butyl]carbamate |
| SMILES | CC(C)NC(=O)C[C@H]1C/C=C\CCC[C@H](Cc2ccccc2)C(=O)OC[C@H](CCCCNC(=O)OCc2ccccc2)CC1=O |
| InChI | InChI=1S/C37H50N2O6/c1-28(2)39-35(41)25-32-20-11-3-4-12-21-33(23-29-15-7-5-8-16-29)36(42)44-27-31(24-34(32)40)19-13-14-22-38-37(43)45-26-30-17-9-6-10-18-30/h3,5-11,15-18,28,31-33H,4,12-14,19-27H2,1-2H3,(H,38,43)(H,39,41)/b11-3-/t31-,32-,33-/m1/s1 |
| InChIKey | CZUAKIXDDNBNCY-LIZKUBKKSA-N |
| XLogP | 6.72 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|