C28H46N2O4 — CID 143884011
2-[(3S,6R,8Z,13R)-13-benzyl-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-propan-2-ylacetamide;molecular hydrogen (PubChem CID 143884011) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is 2-[(3S,6R,8Z,13R)-13-benzyl-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-propan-2-ylacetamide;molecular hydrogen.
| Compound Name | 2-[(3S,6R,8Z,13R)-13-benzyl-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-propan-2-ylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 143884011 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 2-[(3S,6R,8Z,13R)-13-benzyl-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-propan-2-ylacetamide;molecular hydrogen |
| SMILES | CC(C)NC(=O)C[C@H]1C/C=C\CCC[C@H](Cc2ccccc2)C(=O)OC[C@H](C(C)(C)C)NC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C28H42N2O4.2H2/c1-20(2)29-25(31)18-22-15-11-6-7-12-16-23(17-21-13-9-8-10-14-21)27(33)34-19-24(28(3,4)5)30-26(22)32;;/h6,8-11,13-14,20,22-24H,7,12,15-19H2,1-5H3,(H,29,31)(H,30,32);2*1H/b11-6-;;/t22-,23-,24-;;/m1../s1 |
| InChIKey | FYNRGYAXIXYXKW-DMKYVBKCSA-N |
| XLogP | 5.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|