C24H26N2O4 — CID 71760565
(3R,7R,9Z,12S)-12-(1,3-benzodioxol-5-yl)-7-methyl-3-phenyl-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71760565) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (3R,7R,9Z,12S)-12-(1,3-benzodioxol-5-yl)-7-methyl-3-phenyl-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (3R,7R,9Z,12S)-12-(1,3-benzodioxol-5-yl)-7-methyl-3-phenyl-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71760565 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (3R,7R,9Z,12S)-12-(1,3-benzodioxol-5-yl)-7-methyl-3-phenyl-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | C[C@@H]1C/C=C\C[C@@H](c2ccc3c(c2)OCO3)NC(=O)[C@@H](c2ccccc2)CC(=O)N1 |
| InChI | InChI=1S/C24H26N2O4/c1-16-7-5-6-10-20(18-11-12-21-22(13-18)30-15-29-21)26-24(28)19(14-23(27)25-16)17-8-3-2-4-9-17/h2-6,8-9,11-13,16,19-20H,7,10,14-15H2,1H3,(H,25,27)(H,26,28)/b6-5-/t16-,19-,20+/m1/s1 |
| InChIKey | HVIIOAJZRGDWQM-CHWHLMNKSA-N |
| XLogP | 3.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|