C16H15NO3 — CID 669595
N-(2-phenylethyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 669595) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2-phenylethyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-phenylethyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 669595 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(2-phenylethyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15NO3/c18-16(17-9-8-12-4-2-1-3-5-12)13-6-7-14-15(10-13)20-11-19-14/h1-7,10H,8-9,11H2,(H,17,18) |
| InChIKey | KBJGLIJMWJNSKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |