C11H11NO — CID 10035072
2-phenyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 10035072) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | 2-phenyl-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 10035072 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-phenyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1C=CCC(c2ccccc2)N1 |
| InChI | InChI=1S/C11H11NO/c13-11-8-4-7-10(12-11)9-5-2-1-3-6-9/h1-6,8,10H,7H2,(H,12,13) |
| InChIKey | JMCPLOLRWKWQSF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |