C6H7NO3 — CID 15233514
(2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylic acid (PubChem CID 15233514) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylic acid.
| Compound Name | (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 15233514 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | (2S)-6-oxo-2,3-dihydro-1H-pyridine-2-carboxylic acid |
| SMILES | O=C1C=CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C6H7NO3/c8-5-3-1-2-4(7-5)6(9)10/h1,3-4H,2H2,(H,7,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | LPOSNJQWOACRGS-BYPYZUCNSA-N |
| XLogP | -0.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |