About 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid
5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid (PubChem CID 14185060) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid.
Analyze 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid?
The IUPAC name of 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid (CID 14185060) is 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid is CC1=CCC(C(=O)O)N1.
What is the InChIKey of 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid?
The InChIKey is ZCTIIVSOBQJYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-2-3-5(7-4)6(8)9/h2,5,7H,3H2,1H3,(H,8,9).
What are the key properties of 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid?
5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid has a molecular weight of 127.14 g/mol, XLogP of 0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 14185060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).