C13H13NO3 — CID 10681020
[(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]methyl benzoate (PubChem CID 10681020) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is [(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]methyl benzoate.
| Compound Name | [(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10681020 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [(2S)-6-oxo-2,3-dihydro-1H-pyridin-2-yl]methyl benzoate |
| SMILES | O=C1C=CC[C@@H](COC(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C13H13NO3/c15-12-8-4-7-11(14-12)9-17-13(16)10-5-2-1-3-6-10/h1-6,8,11H,7,9H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | AQUBADICNKPVKJ-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |