C19H13NO3 — CID 154720448
(4S)-4-phenyl-3,4-dihydro-1H-benzo[g]quinoline-2,5,10-trione (PubChem CID 154720448) has the molecular formula C19H13NO3 and a molecular weight of 303.32 g/mol. Its IUPAC name is (4S)-4-phenyl-3,4-dihydro-1H-benzo[g]quinoline-2,5,10-trione.
| Compound Name | (4S)-4-phenyl-3,4-dihydro-1H-benzo[g]quinoline-2,5,10-trione |
|---|---|
| PubChem CID | 154720448 |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (4S)-4-phenyl-3,4-dihydro-1H-benzo[g]quinoline-2,5,10-trione |
| SMILES | O=C1C[C@@H](c2ccccc2)C2=C(N1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H13NO3/c21-15-10-14(11-6-2-1-3-7-11)16-17(20-15)19(23)13-9-5-4-8-12(13)18(16)22/h1-9,14H,10H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | ZYFVVFIZMSXOJX-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|