C19H14ClNO — CID 101455260
(2-chlorophenyl)-[(2S,3R)-3-naphthalen-2-ylaziridin-2-yl]methanone (PubChem CID 101455260) has the molecular formula C19H14ClNO and a molecular weight of 307.78 g/mol. Its IUPAC name is (2-chlorophenyl)-[(2S,3R)-3-naphthalen-2-ylaziridin-2-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(2S,3R)-3-naphthalen-2-ylaziridin-2-yl]methanone |
|---|---|
| PubChem CID | 101455260 |
| Molecular Formula | C19H14ClNO |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (2-chlorophenyl)-[(2S,3R)-3-naphthalen-2-ylaziridin-2-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)[C@H]1N[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H14ClNO/c20-16-8-4-3-7-15(16)19(22)18-17(21-18)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,17-18,21H/t17-,18+/m1/s1 |
| InChIKey | RFHVVADQXWZADD-MSOLQXFVSA-N |
| XLogP | 4.39 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|