C38H28O4 — CID 138857842
4-[(1S,2R,3S,4R)-2-(4-carboxyphenyl)-3,4-dinaphthalen-2-ylcyclobutyl]benzoic acid (PubChem CID 138857842) has the molecular formula C38H28O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is 4-[(1S,2R,3S,4R)-2-(4-carboxyphenyl)-3,4-dinaphthalen-2-ylcyclobutyl]benzoic acid.
| Compound Name | 4-[(1S,2R,3S,4R)-2-(4-carboxyphenyl)-3,4-dinaphthalen-2-ylcyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 138857842 |
| Molecular Formula | C38H28O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 4-[(1S,2R,3S,4R)-2-(4-carboxyphenyl)-3,4-dinaphthalen-2-ylcyclobutyl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@@H]2[C@H](c3ccc(C(=O)O)cc3)[C@@H](c3ccc4ccccc4c3)[C@H]2c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C38H28O4/c39-37(40)27-15-11-25(12-16-27)33-34(26-13-17-28(18-14-26)38(41)42)36(32-20-10-24-6-2-4-8-30(24)22-32)35(33)31-19-9-23-5-1-3-7-29(23)21-31/h1-22,33-36H,(H,39,40)(H,41,42)/t33-,34+,35+,36- |
| InChIKey | CTKVVJXKMTVNCX-IYMPVJEUSA-N |
| XLogP | 8.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |