C30H24O5 — CID 155629651
4-[(1S,2R,3S,4R)-2-acetyl-4-(4-formyloxyphenyl)-3-naphthalen-2-ylcyclobutyl]benzoic acid (PubChem CID 155629651) has the molecular formula C30H24O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[(1S,2R,3S,4R)-2-acetyl-4-(4-formyloxyphenyl)-3-naphthalen-2-ylcyclobutyl]benzoic acid.
| Compound Name | 4-[(1S,2R,3S,4R)-2-acetyl-4-(4-formyloxyphenyl)-3-naphthalen-2-ylcyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 155629651 |
| Molecular Formula | C30H24O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-[(1S,2R,3S,4R)-2-acetyl-4-(4-formyloxyphenyl)-3-naphthalen-2-ylcyclobutyl]benzoic acid |
| SMILES | CC(=O)[C@@H]1[C@@H](c2ccc(C(=O)O)cc2)[C@@H](c2ccc(OC=O)cc2)[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H24O5/c1-18(32)26-27(20-7-9-22(10-8-20)30(33)34)28(21-12-14-25(15-13-21)35-17-31)29(26)24-11-6-19-4-2-3-5-23(19)16-24/h2-17,26-29H,1H3,(H,33,34)/t26-,27-,28-,29-/m1/s1 |
| InChIKey | JBMPILXBWBMMGW-CXDXLJMYSA-N |
| XLogP | 5.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|