C54H44O12 — CID 158272562
4-[(1R,2S,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid;4-[(E)-3-oxobut-1-enyl]benzoic acid;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid (PubChem CID 158272562) has the molecular formula C54H44O12 and a molecular weight of 884.93 g/mol. Its IUPAC name is 4-[(1R,2S,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid;4-[(E)-3-oxobut-1-enyl]benzoic acid;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid.
| Compound Name | 4-[(1R,2S,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid;4-[(E)-3-oxobut-1-enyl]benzoic acid;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 158272562 |
| Molecular Formula | C54H44O12 |
| Molecular Weight | 884.93 g/mol |
| Exact Mass | 884.28 |
| IUPAC Name | 4-[(1R,2S,3R,4S)-2-acetyl-3-benzoyl-4-(4-formyloxyphenyl)cyclobutyl]benzoic acid;4-[(E)-3-oxobut-1-enyl]benzoic acid;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
| SMILES | CC(=O)/C=C/c1ccc(C(=O)O)cc1.CC(=O)[C@@H]1[C@H](C(=O)c2ccccc2)[C@@H](c2ccc(OC=O)cc2)[C@H]1c1ccc(C(=O)O)cc1.O=C(O)c1ccc(/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22O6.C16H12O3.C11H10O3/c1-16(29)22-23(17-7-9-20(10-8-17)27(31)32)24(18-11-13-21(14-12-18)33-15-28)25(22)26(30)19-5-3-2-4-6-19;17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19;1-8(12)2-3-9-4-6-10(7-5-9)11(13)14/h2-15,22-25H,1H3,(H,31,32);1-11H,(H,18,19);2-7H,1H3,(H,13,14)/b;11-8+;3-2+/t22-,23-,24-,25-;;/m0../s1 |
| InChIKey | GJFHXVYIFMFOHT-MLAWZSLMSA-N |
| XLogP | 9.77 |
| TPSA | 206.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.93 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|