C18H16O4 — CID 155629640
4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid (PubChem CID 155629640) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid.
| Compound Name | 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid |
|---|---|
| PubChem CID | 155629640 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid |
| SMILES | O=COc1ccc([C@@H]2CC[C@H]2c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H16O4/c19-11-22-15-7-5-13(6-8-15)17-10-9-16(17)12-1-3-14(4-2-12)18(20)21/h1-8,11,16-17H,9-10H2,(H,20,21)/t16-,17-/m0/s1 |
| InChIKey | YWIPOPPNDMYBMU-IRXDYDNUSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|