4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid

C18H16O4 — CID 155629640

IUPAC4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid
SMILESO=COc1ccc([C@@H]2CC[C@H]2c2ccc(C(=O)O)cc2)cc1
InChIInChI=1S/C18H16O4/c19-11-22-15-7-5-13(6-8-15)17-10-9-16(17)12-1-3-14(4-2-12)18(20)21/h1-8,11,16-17H,9-10H2,(H,20,21)/t16-,17-/m0/s1
InChIKeyYWIPOPPNDMYBMU-IRXDYDNUSA-N
MW296.32 g/mol
LogP3.58
Rot. Bonds5

About 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid

4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid (PubChem CID 155629640) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid.

Molecular Properties

Compound Name4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid
PubChem CID155629640
Molecular FormulaC18H16O4
Molecular Weight296.32 g/mol
Exact Mass296.10
IUPAC Name4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid
SMILESO=COc1ccc([C@@H]2CC[C@H]2c2ccc(C(=O)O)cc2)cc1
InChIInChI=1S/C18H16O4/c19-11-22-15-7-5-13(6-8-15)17-10-9-16(17)12-1-3-14(4-2-12)18(20)21/h1-8,11,16-17H,9-10H2,(H,20,21)/t16-,17-/m0/s1
InChIKeyYWIPOPPNDMYBMU-IRXDYDNUSA-N
XLogP3.58
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.32
LogP ≤ 53.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid?
The IUPAC name of 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid (CID 155629640) is 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid.
What is the SMILES notation for 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid?
The canonical SMILES for 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid is O=COc1ccc([C@@H]2CC[C@H]2c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid?
The InChIKey is YWIPOPPNDMYBMU-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H16O4/c19-11-22-15-7-5-13(6-8-15)17-10-9-16(17)12-1-3-14(4-2-12)18(20)21/h1-8,11,16-17H,9-10H2,(H,20,21)/t16-,17-/m0/s1.
What are the key properties of 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid?
4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid has a molecular weight of 296.32 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2R)-2-(4-formyloxyphenyl)cyclobutyl]benzoic acid is sourced from PubChem (CID 155629640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).